| Jinan Wonder Pharmtech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18601195352 | |||
![]() |
wonderpharmtech@gmail.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Tert-butyl 4-(4-methylthiazol-5-yl)benzylcarbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 |
| CAS Registry Number | 2308507-34-6 |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CNC(=O)OC(C)(C)C |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.559, Calc.* |
| Boiling Point | 450.9±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 226.5±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Tert-butyl 4-(4-methylthiazol-5-yl)benzylcarbamate |