| Territorial Sea Technology Qingdao Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15092083467 | |||
![]() |
13675327813@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Thianthrene 5-oxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H8OS2 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 2362-50-7 |
| EC Number | 851-277-7 |
| SMILES | C1=CC=C2C(=C1)SC3=CC=CC=C3S2=O |
| Solubility | 13.8 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.798, Calc.* |
| Melting point | 140.20 ºC |
| Boiling Point | 379.87 ºC, 423.2±15.0 ºC (760 mmHg), Calc.* |
| Flash Point | 209.7±20.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Thianthrene 5-oxide |