|
CAS: 2380230-73-7 Product: 2-[2-[[3-[4-[(4-Methylpiperazin-1-yl)methyl]phenyl]phenyl]carbonylamino]phenyl]ethanoic acid No suppilers available. |
| Name | 2-[2-[[3-[4-[(4-Methylpiperazin-1-yl)methyl]phenyl]phenyl]carbonylamino]phenyl]ethanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.54 |
| CAS Registry Number | 2380230-73-7 |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CC(=CC=C3)C(=O)NC4=CC=CC=C4CC(=O)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.644, Calc.* |
| Boiling Point | 586.6±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 308.5±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[2-[[3-[4-[(4-Methylpiperazin-1-yl)methyl]phenyl]phenyl]carbonylamino]phenyl]ethanoic acid |