| Wuxi LabNetwork | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (27) 5076-6799 | |||
![]() |
vicky_zhu@labnetwork.com | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | tert-Butyl((5-iodo-2,2-dimethylpentyl)oxy)dimethylsilane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H29IOSi |
| Molecular Weight | 356.36 |
| CAS Registry Number | 243458-60-8 |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C)(C)CCCI |
| Solubility | 0.008878 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.475, Calc.* |
| Melting point | 55.42 ºC |
| Boiling Point | 288.40 ºC, 298.6±23.0 ºC (760 mmHg), Calc.* |
| Flash Point | 134.4±22.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for tert-Butyl((5-iodo-2,2-dimethylpentyl)oxy)dimethylsilane |