|
CAS: 247923-41-7 Product: N-((1S,2S)-2-Amino-1,2-diphenylethyl)-2,4,6-triisopropylbenzenesulfonamide No suppilers available. |
| Name | N-((1S,2S)-2-Amino-1,2-diphenylethyl)-2,4,6-triisopropylbenzenesulfonamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C29H38N2O2S |
| Molecular Weight | 478.69 |
| CAS Registry Number | 247923-41-7 |
| EC Number | 827-273-6 |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)N[C@@H](C2=CC=CC=C2)[C@H](C3=CC=CC=C3)N)C(C)C |
| Solubility | 0.003983 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.574, Calc.* |
| Melting point | 250.96 ºC |
| Boiling Point | 582.12 ºC, 584.4±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 307.3±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P305+P351+P338 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for N-((1S,2S)-2-Amino-1,2-diphenylethyl)-2,4,6-triisopropylbenzenesulfonamide |