|
CAS: 25547-51-7 Product: 2-Methyl-3-phenyloxirane-2-carboxylic acid No suppilers available. |
| Name | 2-Methyl-3-phenyloxirane-2-carboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18 |
| CAS Registry Number | 25547-51-7 |
| SMILES | CC1(C(O1)C2=CC=CC=C2)C(=O)O |
| Solubility | 1762 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.575, Calc.* |
| Melting point | 94.34 ºC |
| Boiling Point | 307.05 ºC, 334.3±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 136.7±21.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-phenyloxirane-2-carboxylic acid |