| Mendel Chemicals | Moldova | Inquire | ||
|---|---|---|---|---|
![]() |
+373 78813683 | |||
![]() |
info@mendelchemicals.com | |||
![]() |
WhatsApp: +37378813683 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2024 | ||||
| Name | Phosphoaminophosphonic acid-adenylate ester |
|---|---|
| Synonyms | AMP-PNP;[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]amino]phosphonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17N6O12P3 |
| Molecular Weight | 506.20 |
| CAS Registry Number | 25612-73-1 |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(NP(=O)(O)O)O)O)O)N |
| Density | 2.7±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.941, Calc.* |
| Boiling Point | 965.5±75.0 ºC (760 mmHg), Calc.* |
| Flash Point | 537.7±37.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phosphoaminophosphonic acid-adenylate ester |