| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | 3-(7-(2,4-Dimethoxyphenyl)-2,3,6,7-tetrahydro-(1,4)thiazepin-5-yl)-4-hydroxy-6-methylpyran-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.44 |
| CAS Registry Number | 257292-29-8 |
| SMILES | CC1=CC(=C(C(=O)O1)C2=NCCSC(C2)C3=C(C=C(C=C3)OC)OC)O |
| Solubility | 2.752 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.613, Calc.* |
| Melting point | 235.35 ºC |
| Boiling Point | 525.3±50.0 ºC (760 mmHg), Calc.*, 548.71 ºC |
| Flash Point | 271.5±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P280-P301+P312-P302+P352-P304+P340-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-(7-(2,4-Dimethoxyphenyl)-2,3,6,7-tetrahydro-(1,4)thiazepin-5-yl)-4-hydroxy-6-methylpyran-2-one |