| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Classification | Analytical chemistry >> Standard >> Standard material |
|---|---|
| Name | Dehydronandrolon |
| Synonyms | 17b-Acetyloxy-estra-4,6-diene-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 2590-41-2 |
| EC Number | 643-000-1 |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CC(=O)CC[C@H]34)C |
| Hazard Symbols |
| ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H361f-H373-H411 Details | ||||||||||||||||||||||||||||||||||||||||||||
| Precautionary Statements | P203-P260-P264-P270-P273-P280-P301+P317-P318-P319-P330-P391-P405-P501 Details | ||||||||||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||||||||||
|
Dehydronandrolone, also known as 19-nor-4,9(10)-androstadien-3-one, is a significant chemical compound in the field of steroid chemistry, with notable applications in both research and practical applications. This substance, an anabolic steroid derivative, is characterized by its unique chemical structure, which differentiates it from other steroidal compounds. The discovery of dehydronandrolone emerged from studies on steroid structure-activity relationships. It was identified as a derivative of nandrolone, a well-known anabolic steroid. Nandrolone itself is used in medicine to treat conditions such as anemia and osteoporosis, but dehydronandrolone's distinct chemical modifications offer different properties and potential applications. The primary structural difference in dehydronandrolone is the presence of a 19-nor group, which affects its biological activity and interaction with steroid receptors. The synthesis of dehydronandrolone involves several chemical transformations starting from nandrolone. The process typically includes dehydrogenation reactions, which convert the nandrolone structure to its dehydro derivative. These synthetic pathways are carefully designed to preserve the integrity of the steroid core while introducing modifications that alter its pharmacological profile. In the realm of medicinal chemistry, dehydronandrolone has been explored for its potential anabolic effects. Its unique structure allows it to interact differently with androgen receptors compared to other steroids, making it a candidate for further research into its therapeutic potential. The compound's ability to enhance muscle growth and improve physical performance is of particular interest in the development of treatments for muscle-wasting conditions. Dehydronandrolone's role extends beyond medicine into the field of sports and bodybuilding. As an anabolic steroid, it is sometimes used illicitly to enhance athletic performance and muscle mass. However, its use is controversial and banned in many sports due to concerns about fairness and potential health risks. The compound's effects on muscle tissue, strength, and recovery make it a topic of interest for both legal and illegal applications. Moreover, dehydronandrolone is used in research to better understand steroid hormone actions and receptor interactions. Its distinct chemical properties provide valuable insights into the mechanisms of steroid action, helping to elucidate the broader impacts of anabolic steroids on human physiology. In summary, dehydronandrolone is a chemically modified derivative of nandrolone with unique properties that impact its application in medicine, sports, and research. Its discovery has contributed to the understanding of steroid chemistry and its effects on human health and performance. |
| Market Analysis Reports |
| List of Reports Available for Dehydronandrolon |