| Pribolab Pte. Ltd. | Singapore | Inquire | ||
|---|---|---|---|---|
![]() |
+86 4006885349 | |||
![]() |
sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | 15-Acetoxyscirpenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 |
| CAS Registry Number | 2623-22-5 |
| EC Number | 636-756-9 |
| SMILES | CC1=C[C@@H]2[C@](CC1)([C@]3(C[C@H]([C@H](C34CO4)O2)O)C)COC(=O)C |
| Solubility | 794.6 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.566, Calc.* |
| Melting point | 147.91 ºC |
| Boiling Point | 380.41 ºC, 431.1±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 153.8±22.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P310-P321-P330-P405-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| Transport Information | UN 2811 | ||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 15-Acetoxyscirpenol |