| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 4,5-Dimethyl-2-phenylpyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 |
| CAS Registry Number | 27063-84-9 |
| SMILES | CC1=CC(=NC=C1C)C2=CC=CC=C2 |
| Solubility | 39.51 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.563, Calc.* |
| Melting point | 82.40 ºC |
| Boiling Point | 309.97 ºC, 305.7±11.0 ºC (760 mmHg), Calc.* |
| Flash Point | 129.4±12.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethyl-2-phenylpyridine |