| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 2-(2-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 |
| CAS Registry Number | 2713-62-4 |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)(C(F)(F)F)O)N |
| Solubility | 541.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.455, Calc.* |
| Melting point | 59.37 ºC |
| Boiling Point | 251.41 ºC, 288.9±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 128.5±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |