Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Venlafaxine Impurity 7 |
|---|---|
| Synonyms | N-[2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]formamide |
| Molecular Structure | ![CAS # 272788-07-5, Venlafaxine Impurity 7, N-[2-(1-Hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]formamide](/structures/272788-07-5.gif) |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 |
| CAS Registry Number | 272788-07-5 |
| SMILES | COC1=CC=C(C=C1)C(CNC=O)C2(CCCCC2)O |
| Solubility | 173.3 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.553, Calc.* |
| Melting point | 183.74 ºC |
| Boiling Point | 438.22 ºC, 495.6±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 253.5±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Venlafaxine Impurity 7 |