Online Database of Chemicals from Around the World
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid
[CAS# 27619-97-2]
Complete supplier list of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid
|
Identification
| Name |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
|
| Molecular Structure |
 |
| Molecular Formula |
C8H5F13O3S |
| Molecular Weight |
428.17 |
| CAS Registry Number |
27619-97-2 |
| EC Number |
248-580-6 |
| SMILES |
C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|
Properties
| Solubility |
1.06 mg/L (25 ºC water) |
| Density |
1.7±0.1 g/cm3, Calc.* |
| Index of Refraction |
1.330, Calc.* |
| Melting point |
62.63 ºC |
|
|
*
|
Calculated using Advanced Chemistry Development (ACD/Labs) Software.
|
|
Safety Data
|
Hazard Symbols |
GHS05;GHS07;GHS08;GHS09 Danger Details |
|
Hazard Statements |
H302+H332-H314-H351-H360D-H362-H372-H411 Details |
|
Precautionary Statements |
P260-P263-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 Details |
|
Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
|---|
| Serious eye damage | Eye Dam. | 1 | H318 | | Skin corrosion | Skin Corr. | 1B | H314 | | Acute toxicity | Acute Tox. | 4 | H302 | | Specific target organ toxicity - repeated exposure | STOT RE | 2 | H373 | | Skin corrosion | Skin Corr. | 1A | H314 | | Skin corrosion | Skin Corr. | 1C | H314 | |
|
|
SDS |
Available |
|
| Market Analysis Reports |
|
List of Reports Available for 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid
|
|
Related Products
Tricyclopentadienyllanthanum Tricyclopentadienylneodymium Tricyclopentadienylytterbium Tricyclopentylphosphine Tricyclo[4.3.1.1(3,8)]undecan-3-ol 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoro-1,1-heptanediol Tridecafluorohexanesulfonic acid [2-(Tridecafluorohexyl)ethyl]dimethylchlorosilane 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanal Triclabendazole sulfone Triclabendazole sulfoxide Triclocarban Triclopyr Triclopyr-butotyl Triclopyr triethylamine salt Triclosan Tricobalt tetraoxide n-Tricosane Tricosanoic acid