| Shenzhen Topbatt Chemical Co., Ltd | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (755) 8621-0921 | |||
![]() |
tanp@topbatt.net | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | N-(o-Aminophenyl)-anthranilic acid |
|---|---|
| Synonyms | 2-(2-Aminoanilino)benzoic acid |
| Molecular Structure | ![]() |
| Protein Sequence | X |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 27696-24-8 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC=C2N |
| Solubility | 50.45 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.714, Calc.* |
| Melting point | 171.52 ºC |
| Boiling Point | 417.35 ºC, 417.2±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 206.1±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+351+338-P302+352 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N-(o-Aminophenyl)-anthranilic acid |