| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Analytical standard |
|---|---|
| Name | Azaperol |
| Synonyms | 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.41 |
| CAS Registry Number | 2804-05-9 |
| EC Number | 635-793-8 |
| SMILES | C1CN(CCN1CCCC(C2=CC=C(C=C2)F)O)C3=CC=CC=N3 |
| Solubility | 207.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.577, Calc.* |
| Melting point | 182.05 ºC |
| Boiling Point | 434.61 ºC, 501.7±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 257.2±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P317-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Azaperol |