| Sinbond Industrial Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (531) 8703-8285 +86 13583181986 +44 (208) 242-5518 | |||
![]() |
cici1124@gmail.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2014 | ||||
| Name | Ethyl 8-(2,4-dioxo-2H-benzo[E][1,3]oxazin-3(4H)-YL)octanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 |
| CAS Registry Number | 287935-37-9 |
| EC Number | 854-167-7 |
| SMILES | CCOC(=O)CCCCCCCN1C(=O)C2=CC=CC=C2OC1=O |
| Solubility | 3.541 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.527, Calc.* |
| Melting point | 219.35 ºC |
| Boiling Point | 514.46 ºC, 453.0±47.0 ºC (760 mmHg), Calc.* |
| Flash Point | 227.8±29.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302+H312+H332-H302-H312-H315-H319-H332-H335 Details | ||||||||||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Ethyl 8-(2,4-dioxo-2H-benzo[E][1,3]oxazin-3(4H)-YL)octanoate |