| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2-[3,5-bis(trifluoromethyl)phenyl]propanoic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H8F6O2 |
| Molecular Weight | 286.17 |
| CAS Registry Number | 289686-73-3 |
| EC Number | 878-318-1 |
| SMILES | CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O |
| Solubility | 22.03 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.430, Calc.* |
| Melting point | 74.97 ºC |
| Boiling Point | 282.51 ºC, 226.5±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 90.8±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-[3,5-bis(trifluoromethyl)phenyl]propanoic Acid |