| Shanghai Uchem Inc. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 5676-2820 | |||
![]() |
rzhang@myuchem.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 1,3,5-Tris(4-nitrophenyl)benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C24H15N3O6 |
| Molecular Weight | 441.39 |
| CAS Registry Number | 29102-61-2 |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)[N+](=O)[O-])C4=CC=C(C=C4)[N+](=O)[O-])[N+](=O)[O-] |
| Solubility | 0.09034 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.669, Calc.* |
| Melting point | 349.84 ºC |
| Boiling Point | 807.44 ºC, 641.0±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 297.9±22.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tris(4-nitrophenyl)benzene |