| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 4-Bromo-1,2-dioctoxybenzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H37BrO2 |
| Molecular Weight | 413.43 |
| CAS Registry Number | 291753-67-8 |
| SMILES | CCCCCCCCOC1=C(C=C(C=C1)Br)OCCCCCCCC |
| Solubility | 2.355e-005 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.495, Calc.* |
| Melting point | 156.80 ºC |
| Boiling Point | 426.96 ºC, 452.1±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 146.6±18.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-1,2-dioctoxybenzene |