| Baoji Herbest Bio-tech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (917) 888-1635 | |||
![]() |
root@herbest.cn | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink standard supplier since 2008 | ||||
| Name | Isoengeletin |
|---|---|
| Synonyms | (2R,3S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22O10 |
| Molecular Weight | 434.39 |
| CAS Registry Number | 30987-58-7 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@H](OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
| Density | 1.7±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.722, Calc.* |
| Boiling Point | 763.4±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 270.6±26.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Isoengeletin |