| Shandong Binlaichem Pharmaceutical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15963310191 | |||
![]() |
sales@binlaichem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 3-Fluoropropyl 4-methylbenzenesulfonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H13FO3S |
| Molecular Weight | 232.27 |
| CAS Registry Number | 312-68-5 |
| EC Number | 695-356-2 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCF |
| Solubility | 269.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.494, Calc.* |
| Melting point | 98.66 ºC |
| Boiling Point | 327.31 ºC, 341.0±22.0 ºC (760 mmHg), Calc.* |
| Flash Point | 160.0±22.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3-Fluoropropyl 4-methylbenzenesulfonate |