| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Cholesterol EP Impurity B |
|---|---|
| Synonyms | Desmosterol;(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.64 |
| CAS Registry Number | 313-04-2 |
| EC Number | 206-236-2 |
| SMILES | C[C@H](CCC=C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Solubility | 0.0005022 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.536, Calc.* |
| Melting point | 164.72 ºC |
| Boiling Point | 440.16 ºC, 483.2±14.0 ºC (760 mmHg), Calc.* |
| Flash Point | 209.2±12.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Cholesterol EP Impurity B |