BOC Sciences | USA | Inquire | ||
---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
Chemical manufacturer | ||||
chemBlink standard supplier since 2010 | ||||
Name | Erythronolide B |
---|---|
Synonyms | (3R,4S,5S,6R,7R,9R,11R,12S,13R,14R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
Molecular Structure | ![]() |
Molecular Formula | C21H38O7 |
Molecular Weight | 402.52 |
CAS Registry Number | 3225-82-9 |
SMILES | CC[C@@H]1[C@@H]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O)C)O)(C)O)C)C)O)C |
Solubility | 582.7 mg/L (25 ºC water) |
---|---|
Density | 1.1±0.1 g/cm3, Calc.* |
Index of Refraction | 1.474, Calc.* |
Melting point | 249.19 ºC |
Boiling Point | 578.34 ºC, 576.2±50.0 ºC (760 mmHg), Calc.* |
Flash Point | 192.2±23.6 ºC, Calc.* |
* | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
Market Analysis Reports |
List of Reports Available for Erythronolide B |