| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Erythronolide B |
|---|---|
| Synonyms | (3R,4S,5S,6R,7R,9R,11R,12S,13R,14R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.52 |
| CAS Registry Number | 3225-82-9 |
| SMILES | CC[C@@H]1[C@@H]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O)C)O)(C)O)C)C)O)C |
| Solubility | 582.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.474, Calc.* |
| Melting point | 249.19 ºC |
| Boiling Point | 578.34 ºC, 576.2±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 192.2±23.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Erythronolide B |