| Hangzhou Verychem Science And Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.verychem.com | |||
![]() | +86 (571) 8816-2785 +86 13606544505 | |||
![]() | +86 (571) 8816-2787 | |||
![]() | lucy@verychem.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Massive supplier since 2021 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound |
|---|---|
| Name | 2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]ethanamine hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl2F3N2 |
| Molecular Weight | 261.07 |
| CAS Registry Number | 326816-37-9 |
| EC Number | 854-522-6 |
| SMILES | C1=C(C=NC(=C1Cl)CCN)C(F)(F)F.Cl |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
|
2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]ethylamine hydrochloride, commonly known as CF3-CPA, is a well-known compound with a variety of applications in medicinal chemistry and drug research. CF3-CPA was originally synthesized by researchers exploring new derivatives of pyridine with the goal of enhancing biological activity through structural modifications. The synthesis of the compound involves the selective chlorination of 2-(trifluoromethyl)pyridine followed by acetylation to give the crystalline salt form of the hydrochloride. This process ensures high purity and stability, which is essential for pharmaceutical applications. CF3-CPA is characterized by its unique molecular structure with a chlorinated pyridine ring fused to trifluoromethyl and ethylamine moieties. These structural elements contribute to its pharmacological properties, influencing the interaction with biological targets. The compound exhibits favorable pharmacological properties, which are mainly attributed to its interaction with specific receptors or enzymes involved in various disease pathways. The interaction of CF3-CPA with neurotransmitter systems or receptors may have implications for neurological disorders, including possible therapeutic benefits in conditions that affect cognition or mood regulation. Initial studies suggest that CF3-CPA has the potential to serve as a lead compound for oncology studies, potentially targeting specific cancer cell pathways or enhancing chemotherapy effects. The compound’s chemical structure suggests potential antimicrobial activity, prompting studies of its efficacy against drug-resistant bacterial strains or viral infections. Drug development for CF3-CPA involves rigorous preclinical evaluation of its safety, pharmacokinetics, and efficacy in disease models. These studies are a critical step toward potential clinical trials, where its efficacy can be further validated in human subjects. Future studies aim to expand the therapeutic applications of CF3-CPA by: further optimizing its structure to enhance potency or selectivity against specific biological targets; exploring alternative formulations to improve bioavailability and patient compliance; and initiating clinical trials to evaluate safety and efficacy in target patient populations, leading to possible regulatory approval and commercialization. |
| Market Analysis Reports |