|
CAS: 32852-95-2 Product: 2-(3-Phenoxyphenyl)propiononitrile No suppilers available. |
| Name | 2-(3-Phenoxyphenyl)propiononitrile |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| CAS Registry Number | 32852-95-2 |
| EC Number | 251-260-9 |
| SMILES | CC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2 |
| Solubility | 6.419 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.570, Calc.* |
| Melting point | 109.03 ºC |
| Boiling Point | 357.07 ºC, 350.7±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 148.0±17.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Phenoxyphenyl)propiononitrile |