| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Natural biochemical product |
|---|---|
| Name | Tetrahydrorhombifoline |
| Synonyms | (1S,2R,9R)-11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.36 |
| CAS Registry Number | 3382-84-1 |
| SMILES | C=CCCN1C[C@H]2C[C@@H](C1)[C@H]3CCCC(=O)N3C2 |
| Solubility | 196.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.556, Calc.* |
| Melting point | 133.32 ºC |
| Boiling Point | 384.8±41.0 ºC (760 mmHg), Calc.*, 370.81 ºC |
| Flash Point | 162.0±20.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Tetrahydrorhombifoline |