| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | 4H-thieno[3,2-c]chromene-2-carbohydrazide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.28 |
| CAS Registry Number | 351003-40-2 |
| SMILES | C1C2=C(C3=CC=CC=C3O1)SC(=C2)C(=O)NN |
| Solubility | 38.93 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.687, Calc.* |
| Melting point | 193.76 ºC |
| Boiling Point | 459.66 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4H-thieno[3,2-c]chromene-2-carbohydrazide |