| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 5,6-Dichloro-3-hydroxy-2-iminopyrimidin-4-amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H4Cl2N4O |
| Molecular Weight | 195.01 |
| CAS Registry Number | 35139-68-5 |
| SMILES | C1(=C(N(C(=N)N=C1Cl)O)N)Cl |
| Solubility | 7.184e+004 mg/L (25 ºC water) |
|---|---|
| Density | 2.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.785, Calc.* |
| Melting point | 144.25 ºC |
| Boiling Point | 353.68 ºC, 498.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 255.3±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichloro-3-hydroxy-2-iminopyrimidin-4-amine |