Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Plerixafor Methyl Impurity |
|---|---|
| Synonyms | 1-(4-Methylbenzyl)-1,4,8,11-tetraazacyclotetradecane |
| Molecular Structure |  |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.47 |
| CAS Registry Number | 351472-73-6 |
| SMILES | CC1=CC=C(C=C1)CN2CCCNCCNCCCNCC2 |
| Solubility | 4855 mg/L (25 ºC water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.494, Calc.* |
| Melting point | 187.98 ºC |
| Boiling Point | 447.29 ºC, 449.0±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 233.9±23.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Plerixafor Methyl Impurity |