| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]()  | 
+86 (551) 6288-8437  +86 18096409024  | |||
![]()  | 
info@purerechem.com | |||
![]()  | 
Skype Chat | |||
![]()  | 
QQ chat | |||
![]()  | 
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Icomethasone 21-Mesylate | 
|---|---|
| Synonyms | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate | 
| Molecular Structure | ![]()  | 
| Molecular Formula | C23H31ClO7S | 
| Molecular Weight | 487.01 | 
| CAS Registry Number | 352315-75-4 | 
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COS(=O)(=O)C)O)C)O)Cl)C | 
| Density | 1.4±0.1 g/cm3, Calc.* | 
|---|---|
| Index of Refraction | 1.601, Calc.* | 
| Boiling Point | 682.2±55.0 ºC (760 mmHg), Calc.* | 
| Flash Point | 366.4±31.5 ºC, Calc.* | 
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. | 
| SDS | Available | 
|---|---|
| Market Analysis Reports | 
| List of Reports Available for Icomethasone 21-Mesylate |