| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 17beta-Dihydroequilin |
|---|---|
| Synonyms | (9S,13S,14S,17S)-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 3563-27-7 |
| EC Number | 222-633-3 |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=C4)O)[C@@H]1CC[C@@H]2O |
| Solubility | 113.6 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.637, Calc.* |
| Melting point | 157.75 ºC |
| Boiling Point | 399.36 ºC, 457.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 217.2±23.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H312-H332 Details | ||||||||||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P317-P302+P352-P304+P340-P317-P321-P330-P362+P364-P501 Details | ||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 17beta-Dihydroequilin |