| Baoji Herbest Bio-tech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (917) 888-1635 | |||
![]() |
root@herbest.cn | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink standard supplier since 2008 | ||||
| Name | Questinol |
|---|---|
| Synonyms | 1,6-dihydroxy-3-(hydroxymethyl)-8-methoxyanthracene-9,10-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| CAS Registry Number | 35688-09-6 |
| SMILES | COC1=CC(=CC2=C1C(=O)C3=C(C2=O)C=C(C=C3O)CO)O |
| Solubility | 120.9 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.708, Calc.* |
| Melting point | 218.19 ºC |
| Boiling Point | 511.96 ºC, 630.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 241.4±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338-P302+352 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Questinol |