| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Levetiracetam Impurity 10 |
|---|---|
| Synonyms | (2s)-2-(2-Oxopyrrolidin-1-yl)butanoic acid methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 |
| CAS Registry Number | 358629-51-3 |
| EC Number | 642-913-2 |
| SMILES | CC[C@@H](C(=O)OC)N1CCCC1=O |
| Solubility | 9893 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.483, Calc.* |
| Melting point | 80.79 ºC |
| Boiling Point | 299.54 ºC, 309.0±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 140.7±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||
| Market Analysis Reports |
| List of Reports Available for Levetiracetam Impurity 10 |