| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Classification | Biochemical >> Carbohydrate >> Monosaccharide |
|---|---|
| Name | 1-Chloro-3,5-di(4-chlorbenzoyl)-2-deoxy-D-ribose |
| Synonyms | (2R,3S)-5-Chloro-2-(((4-chlorobenzoyl)oxy)methyl)tetrahydrofuran-3-yl 4-chlorobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15Cl3O5 |
| Molecular Weight | 429.68 |
| CAS Registry Number | 3601-90-9 (21740-23-8) |
| EC Number | 695-046-7 |
| SMILES | C1[C@@H]([C@H](OC1Cl)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl |
| Solubility | 0.1785 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.610, Calc.* |
| Melting point | 168.97 ºC |
| Boiling Point | 461.70 ºC, 530.6±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 193.1±29.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3,5-di(4-chlorbenzoyl)-2-deoxy-D-ribose |