Online Database of Chemicals from Around the World
| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 15813355568 | |||
 |
lanningsale@sina.com | |||
 |
QQ chat | |||
 |
WeChat: 15813355568 | |||
 |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Cefradine Impurity 1 |
|---|---|
| Synonyms | 4',5'-Dihydrocefradine;(6R,7R)-7-[[2-amino-2-(cyclohexen-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Molecular Structure | ![CAS # 37051-00-6, Cefradine Impurity 1, 4',5'-Dihydrocefradine,(6R,7R)-7-[[2-amino-2-(cyclohexen-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](/structures/37051-00-6.gif) |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.42 |
| CAS Registry Number | 37051-00-6 |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)C(C3=CCCCC3)N)SC1)C(=O)O |
| Solubility | 1787 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.661, Calc.* |
| Melting point | 326.01 ºC |
| Boiling Point | 630.58 ºC, 681.9±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 366.2±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Cefradine Impurity 1 |