| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 1-(Methylsulfonyl)-1H-benzotriazole |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.21 |
| CAS Registry Number | 37073-15-7 |
| EC Number | 625-247-7 |
| SMILES | CS(=O)(=O)N1C2=CC=CC=C2N=N1 |
| Solubility | 5.96e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.699, Calc.* |
| Melting point | 135.06 ºC |
| Boiling Point | 352.78 ºC, 378.2±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 182.5±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H318 Details | ||||||||||||||||
| Precautionary Statements | P280-P301+P312+P330-P305+P351+P338+P310 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1-(Methylsulfonyl)-1H-benzotriazole |