| Guangzhou Topwork Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (20) 8731-7062 +86 13544492387 | |||
![]() |
sales@topworkchem.com topwork2004@hotmail.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13544492387 | |||
![]() |
WhatsApp: 13544492387 | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink standard supplier since 2006 | ||||
| Name | Ganaxolone |
|---|---|
| Synonyms | 1-[(3R,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.52 |
| CAS Registry Number | 38398-32-2 |
| EC Number | 685-364-4 |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@](C4)(C)O)C)C |
| Solubility | 4.221 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.518, Calc.* |
| Melting point | 150.87 ºC |
| Boiling Point | 395.97 ºC, 434.8±18.0 ºC (760 mmHg), Calc.* |
| Flash Point | 185.4±13.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302+H312+H332-H302-H312-H332 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P317-P302+P352-P304+P340-P317-P321-P330-P362+P364-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Ganaxolone |