| Territorial Sea Technology Qingdao Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15092083467 | |||
![]() |
13675327813@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 2-Naphthyl trifluoromethanesulfonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H7F3O3S |
| Molecular Weight | 276.23 |
| CAS Registry Number | 3857-83-8 |
| EC Number | 624-190-5 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OS(=O)(=O)C(F)(F)F |
| Solubility | 2.831 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.561, Calc.* |
| Melting point | 117.40 ºC |
| Boiling Point | 355.07 ºC, 343.8±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 161.7±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H314-H318 Details | ||||||||||||||||||||||||
| Precautionary Statements | P260-P264-P264+P265-P280-P301+P330+P331-P302+P361+P354-P304+P340-P305+P354+P338-P316-P317-P321-P363-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-Naphthyl trifluoromethanesulfonate |