| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Vinpocetine impurity N |
|---|---|
| Synonyms | Methyl (41R,12R,13aR)-13a-ethyl-12-hydroxy-2,3,41,5,6,12,13,13a-octahydro-1h-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridine-12-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.44 |
| CAS Registry Number | 38990-16-8 |
| SMILES | CC[C@]12CCCN3[C@H]1c4c(c5ccccc5n4[C@@](C2)(C(=O)OC)O)CC3 |
| Solubility | 133.3 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.682, Calc.* |
| Melting point | 188.19 ºC |
| Boiling Point | 447.74 ºC, 508.9±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 261.6±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Vinpocetine impurity N |