| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | 5,5'-Isopropylidenebis(m-xylene-2,a,a'-triol) |
|---|---|
| Synonyms | 4-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]propan-2-yl]-2,6-bis(hydroxymethyl)phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 |
| CAS Registry Number | 3957-22-0 |
| EC Number | 223-553-1 |
| SMILES | CC(C)(C1=CC(=C(C(=C1)CO)O)CO)C2=CC(=C(C(=C2)CO)O)CO |
| Solubility | 1.142e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.659, Calc.* |
| Melting point | 251.72 ºC |
| Boiling Point | 583.75 ºC, 564.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 261.4±23.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P271-P280-P302-P304-P305-P313-P332-P337-P338-P340-P351-P352 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Isopropylidenebis(m-xylene-2,a,a'-triol) |