| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Fluticasone Furoate 11-Keto Impurity |
|---|---|
| Synonyms | (6S,8S,9R,10S,13S,14S,16R,17R)-6,9-Difluoro-17-(((fluoromethyl)thio)carbonyl)-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl furan-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C27H27F3O6S |
| Molecular Weight | 536.56 |
| CAS Registry Number | 397864-56-1 |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3(C(=O)C[C@@]2([C@]1(C(=O)SCF)OC(=O)C5=CC=CO5)C)F)C)F |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.578, Calc.* |
| Boiling Point | 619.6±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 328.5±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Fluticasone Furoate 11-Keto Impurity |