| China fortune way company | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (10) 8466-3220 +86 17865159269 | |||
![]() |
rnd@sinopharm.com | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.47 |
| CAS Registry Number | 413624-71-2 |
| SMILES | CC(C)(CCCCCC(=O)CCCCCC(C)(C)C(=O)O)C(=O)O |
| Density | 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.479, Calc.* |
| Boiling Point | 524.0±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 284.8±22.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid |