Online Database of Chemicals from Around the World
| Shanghai Zzbio Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 15102117276 | |||
 |
3001090745@qq.com info@zzsrm.com | |||
 |
QQ chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | DL-Homocysteine-d4 |
|---|---|
| Synonyms | Homocysteine-?3,?3,?4,?4-?d4;2-Amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid |
| Molecular Structure |  |
| Molecular Formula | C4H5D4NO2S |
| Molecular Weight | 139.21 |
| CAS Registry Number | 416845-90-4 |
| SMILES | [2H]C([2H])(C(C(=O)O)N)C([2H])([2H])S |
| Melting point | >230 ºC (dec.) |
|---|---|
| Density | 1.3±0.1 g/cm3 |
| Boiling point | 299.7±35.0 ºC (760 mmHg), Calc. |
| Flash point | 135.0±25.9 ºC, Calc, |
| Refractive index | 1.538 |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for DL-Homocysteine-d4 |