| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Naphtho[1,2,3-kl]xanthen-11-ol |
|---|---|
| Synonyms | 8-oxapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-4-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O2 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 43090-41-1 |
| SMILES | C1=CC=C2C3=C4C(=CC=C3)OC5=C(C4=CC2=C1)C=C(C=C5)O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.803, Calc.* |
| Boiling Point | 552.2±29.0 ºC (760 mmHg), Calc.* |
| Flash Point | 284.4±18.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Naphtho[1,2,3-kl]xanthen-11-ol |