| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | (R)-Tert-butyl (1-(pyrrolidin-3-YL)cyclopropyl)carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 431058-52-5 |
| EC Number | 892-880-5 |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)[C@@H]2CCNC2 |
| Solubility | 3138 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.510, Calc.* |
| Melting point | 99.43 ºC |
| Boiling Point | 303.53 ºC, 330.9±31.0 ºC (760 mmHg), Calc.* |
| Flash Point | 153.9±24.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (R)-Tert-butyl (1-(pyrrolidin-3-YL)cyclopropyl)carbamate |