| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 2,2-Bis(trifluoromethyl)propionic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C5H4F6O2 |
| Molecular Weight | 210.07 |
| CAS Registry Number | 45048-36-0 |
| EC Number | 692-033-8 |
| SMILES | CC(C(=O)O)(C(F)(F)F)C(F)(F)F |
| Solubility | 1088 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.322, Calc.* |
| Melting point | 4.99 ºC |
| Boiling Point | 135.81 ºC, 131.5±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 33.3±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H314-H335 Details | ||||||||||||
| Precautionary Statements | P260-P261-P264-P271-P280-P301+P310+P330+P331-P303+P361+P353+P310-P304+P340+P310-P305+P351+P338+P310-P363-P403+P233-P405-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(trifluoromethyl)propionic acid |