| Jinan Wonder Pharmtech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18601195352 | |||
![]() |
wonderpharmtech@gmail.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | 1-Methyl-4-nitro-1H-imidazol-5-amine |
| Synonyms | 3-methyl-5-nitroimidazol-4-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 |
| CAS Registry Number | 4531-54-8 |
| EC Number | 813-053-7 |
| SMILES | CN1C=NC(=C1N)[N+](=O)[O-] |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.699, Calc.* |
| Melting point | 209.05 ºC |
| Boiling Point | 492.41 ºC, 435.0±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 216.9±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335-H340-H350-H360 Details | ||||||||||||||||||||||||||||||||||||
| Precautionary Statements | P203-P261-P264-P264+P265-P270-P271-P280-P281-P301+P317-P302+P352-P304+P340-P305+P351+P338-P318-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-nitro-1H-imidazol-5-amine |