| Chengdu Push Bio-technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (028) 8537-0506-229 | |||
![]() |
3004654993@qq.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18080489829 | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Biochemical >> Natural biochemical product |
|---|---|
| Name | (Z)-tonghaosu |
| Synonyms | (2Z)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]non-3-ene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 4575-53-5 |
| EC Number | 853-475-9 |
| SMILES | CC#CC#C/C=C\1/C=CC2(O1)CCCO2 |
| Solubility | 24.16 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.581, Calc.* |
| Melting point | 108.76 ºC |
| Boiling Point | 354.4±42.0 ºC (760 mmHg), Calc.*, 302.03 ºC |
| Flash Point | 152.8±27.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for (Z)-tonghaosu |