| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15813355568 | |||
![]() |
lanningsale@sina.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15813355568 | |||
![]() |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (2β,3β,5β)-2,3,14,20,22,25-Hexahydroxycholestan-6-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.65 |
| CAS Registry Number | 457603-63-3 |
| SMILES | CC(C)(O)CCC(O)[C@](C)(O)[C@H]1CC[C@@]2(O)[C@@H]3CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@@]21C |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.585, Calc.* |
| Boiling Point | 680.1±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 379.1±28.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (2β,3β,5β)-2,3,14,20,22,25-Hexahydroxycholestan-6-one |